C20H18F3N5OS — CID 162725459
6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethylsulfanyloxy)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 162725459) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethylsulfanyloxy)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethylsulfanyloxy)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162725459 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethylsulfanyloxy)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CN1CCN(c2ccc(-c3cc(OSC(F)(F)F)c4c(C#N)cnn4c3)cc2)CC1 |
| InChI | InChI=1S/C20H18F3N5OS/c1-26-6-8-27(9-7-26)17-4-2-14(3-5-17)15-10-18(29-30-20(21,22)23)19-16(11-24)12-25-28(19)13-15/h2-5,10,12-13H,6-9H2,1H3 |
| InChIKey | OKRXTBXQIMESMU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|