C14H11F5N4O3S — CID 166792897
[3-cyano-6-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 166792897) has the molecular formula C14H11F5N4O3S and a molecular weight of 410.32 g/mol. Its IUPAC name is [3-cyano-6-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [3-cyano-6-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166792897 |
| Molecular Formula | C14H11F5N4O3S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | [3-cyano-6-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | N#Cc1cnn2cc(N3CCC(F)(F)CC3)cc(OS(=O)(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C14H11F5N4O3S/c15-13(16)1-3-22(4-2-13)10-5-11(26-27(24,25)14(17,18)19)12-9(6-20)7-21-23(12)8-10/h5,7-8H,1-4H2 |
| InChIKey | DZGBIDSQGOOPBW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|