C22H26F3N7O5S — CID 175714476
tert-butyl piperazine-1-carboxylate;[3-cyano-6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 175714476) has the molecular formula C22H26F3N7O5S and a molecular weight of 557.56 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;[3-cyano-6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | tert-butyl piperazine-1-carboxylate;[3-cyano-6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175714476 |
| Molecular Formula | C22H26F3N7O5S |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;[3-cyano-6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cn1cc(-c2cc(OS(=O)(=O)C(F)(F)F)c3c(C#N)cnn3c2)cn1 |
| InChI | InChI=1S/C13H8F3N5O3S.C9H18N2O2/c1-20-6-10(5-18-20)8-2-11(24-25(22,23)13(14,15)16)12-9(3-17)4-19-21(12)7-8;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2,4-7H,1H3;10H,4-7H2,1-3H3 |
| InChIKey | FYXZURSUTYNOJL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 143.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|