C22H15F3N4O4S — CID 86594742
[3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl] trifluoromethanesulfonate (PubChem CID 86594742) has the molecular formula C22H15F3N4O4S and a molecular weight of 488.45 g/mol. Its IUPAC name is [3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl] trifluoromethanesulfonate.
| Compound Name | [3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86594742 |
| Molecular Formula | C22H15F3N4O4S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl] trifluoromethanesulfonate |
| SMILES | Cc1c(OS(=O)(=O)C(F)(F)F)cn2ncc(C#N)c(Nc3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C22H15F3N4O4S/c1-14-19(33-34(30,31)22(23,24)25)13-29-21(14)20(15(11-26)12-27-29)28-16-7-9-18(10-8-16)32-17-5-3-2-4-6-17/h2-10,12-13,28H,1H3 |
| InChIKey | OLRLXOOPDRJMSX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|