C27H28N6O2 — CID 20791559
3-cyano-N-[3-(dimethylamino)propyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide (PubChem CID 20791559) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-cyano-N-[3-(dimethylamino)propyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide.
| Compound Name | 3-cyano-N-[3-(dimethylamino)propyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 20791559 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 3-cyano-N-[3-(dimethylamino)propyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN(C)C)cn2ncc(C#N)c(Nc3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C27H28N6O2/c1-19-24(27(34)29-14-7-15-32(2)3)18-33-26(19)25(20(16-28)17-30-33)31-21-10-12-23(13-11-21)35-22-8-5-4-6-9-22/h4-6,8-13,17-18,31H,7,14-15H2,1-3H3,(H,29,34) |
| InChIKey | DZKSVRSLSAOKRA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|