C28H29N5O3 — CID 22179707
3-cyano-N-(6-hydroxyhexyl)-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide (PubChem CID 22179707) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-cyano-N-(6-hydroxyhexyl)-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide.
| Compound Name | 3-cyano-N-(6-hydroxyhexyl)-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 22179707 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-cyano-N-(6-hydroxyhexyl)-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCCCO)cn2ncc(C#N)c(Nc3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C28H29N5O3/c1-20-25(28(35)30-15-7-2-3-8-16-34)19-33-27(20)26(21(17-29)18-31-33)32-22-11-13-24(14-12-22)36-23-9-5-4-6-10-23/h4-6,9-14,18-19,32,34H,2-3,7-8,15-16H2,1H3,(H,30,35) |
| InChIKey | HBNNFBHEXBWEBL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|