C25H22N6O5S — CID 91450403
3-cyano-N-[1-(formylsulfonylamino)ethyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide (PubChem CID 91450403) has the molecular formula C25H22N6O5S and a molecular weight of 518.56 g/mol. Its IUPAC name is 3-cyano-N-[1-(formylsulfonylamino)ethyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide.
| Compound Name | 3-cyano-N-[1-(formylsulfonylamino)ethyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 91450403 |
| Molecular Formula | C25H22N6O5S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 3-cyano-N-[1-(formylsulfonylamino)ethyl]-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)NS(=O)(=O)C=O)cn2ncc(C#N)c(Nc3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C25H22N6O5S/c1-16-22(25(33)28-17(2)30-37(34,35)15-32)14-31-24(16)23(18(12-26)13-27-31)29-19-8-10-21(11-9-19)36-20-6-4-3-5-7-20/h3-11,13-15,17,29-30H,1-2H3,(H,28,33) |
| InChIKey | BTSZAHQGSVJCAW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|