C23H23N5O4 — CID 134496858
[1-[4-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)phenyl]-4-formylpiperidin-4-yl]carbamic acid (PubChem CID 134496858) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is [1-[4-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)phenyl]-4-formylpiperidin-4-yl]carbamic acid.
| Compound Name | [1-[4-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)phenyl]-4-formylpiperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 134496858 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [1-[4-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)phenyl]-4-formylpiperidin-4-yl]carbamic acid |
| SMILES | CCOc1cc(-c2ccc(N3CCC(C=O)(NC(=O)O)CC3)cc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C23H23N5O4/c1-2-32-19-11-20(21-17(12-24)13-25-28(21)14-19)16-3-5-18(6-4-16)27-9-7-23(15-29,8-10-27)26-22(30)31/h3-6,11,13-15,26H,2,7-10H2,1H3,(H,30,31) |
| InChIKey | YSHHOWMBGNLFOW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|