C17H18F6N4O4 — CID 162726573
(12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene-6,9-diol (PubChem CID 162726573) has the molecular formula C17H18F6N4O4 and a molecular weight of 456.34 g/mol. Its IUPAC name is (12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene-6,9-diol.
| Compound Name | (12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene-6,9-diol |
|---|---|
| PubChem CID | 162726573 |
| Molecular Formula | C17H18F6N4O4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene-6,9-diol |
| SMILES | C[C@@H]1CCC(O)CCC(O)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2N)O1 |
| InChI | InChI=1S/C17H18F6N4O4/c1-7-2-3-8(28)4-5-15(29,17(21,22)23)14-27-26-13(31-14)11-10(24)6-9(16(18,19)20)12(25-11)30-7/h6-8,28-29H,2-5,24H2,1H3/t7-,8?,15?/m1/s1 |
| InChIKey | UPQPCNBIMRHXJK-RIGDDMJQSA-N |
| XLogP | 3.18 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |