C30H38F6N4O6 — CID 162726595
tert-butyl N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]-10-hydroxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-17-yl]carbamate;ethane (PubChem CID 162726595) has the molecular formula C30H38F6N4O6 and a molecular weight of 664.64 g/mol. Its IUPAC name is tert-butyl N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]-10-hydroxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-17-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]-10-hydroxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-17-yl]carbamate;ethane |
|---|---|
| PubChem CID | 162726595 |
| Molecular Formula | C30H38F6N4O6 |
| Molecular Weight | 664.64 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | tert-butyl N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]-10-hydroxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-17-yl]carbamate;ethane |
| SMILES | C=C/C=C(\C=C)COC1(C(F)(F)F)CCCC(O)CCOc2nc(c(NC(=O)OC(C)(C)C)cc2C(F)(F)F)-c2nnc1o2.CC |
| InChI | InChI=1S/C28H32F6N4O6.C2H6/c1-6-9-16(7-2)15-42-26(28(32,33)34)12-8-10-17(39)11-13-41-21-18(27(29,30)31)14-19(35-24(40)44-25(3,4)5)20(36-21)22-37-38-23(26)43-22;1-2/h6-7,9,14,17,39H,1-2,8,10-13,15H2,3-5H3,(H,35,40);1-2H3/b16-9+; |
| InChIKey | QUCHRJSXLFKJEW-QOVZSLTQSA-N |
| XLogP | 7.91 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|