C28H36F6N4O4 — CID 162726772
(12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol;ethane (PubChem CID 162726772) has the molecular formula C28H36F6N4O4 and a molecular weight of 606.61 g/mol. Its IUPAC name is (12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol;ethane.
| Compound Name | (12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol;ethane |
|---|---|
| PubChem CID | 162726772 |
| Molecular Formula | C28H36F6N4O4 |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | (12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol;ethane |
| SMILES | CC.CC.C[C@@H]1CCCC(O)CC(OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2N)O1 |
| InChI | InChI=1S/C24H24F6N4O4.2C2H6/c1-13-6-5-9-15(35)11-22(24(28,29)30,36-12-14-7-3-2-4-8-14)21-34-33-20(38-21)18-17(31)10-16(23(25,26)27)19(32-18)37-13;2*1-2/h2-4,7-8,10,13,15,35H,5-6,9,11-12,31H2,1H3;2*1-2H3/t13-,15?,22?;;/m1../s1 |
| InChIKey | SWBPPWPOUDQZDY-PXJCTRACSA-N |
| XLogP | 7.46 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |