C13H21N — CID 162727015
(1Z,3Z)-N-[(1-methylcyclopentyl)methyl]hexa-1,3,5-trien-1-amine (PubChem CID 162727015) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (1Z,3Z)-N-[(1-methylcyclopentyl)methyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N-[(1-methylcyclopentyl)methyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 162727015 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (1Z,3Z)-N-[(1-methylcyclopentyl)methyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C=C/NCC1(C)CCCC1 |
| InChI | InChI=1S/C13H21N/c1-3-4-5-8-11-14-12-13(2)9-6-7-10-13/h3-5,8,11,14H,1,6-7,9-10,12H2,2H3/b5-4-,11-8- |
| InChIKey | OVBKHQSSOOSDAB-YMVJEYMASA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|