C22H21ClN8 — CID 162728639
12-(4-chloro-2-methylindazol-5-yl)-7-(3,6-diazabicyclo[3.2.1]octan-3-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 162728639) has the molecular formula C22H21ClN8 and a molecular weight of 432.92 g/mol. Its IUPAC name is 12-(4-chloro-2-methylindazol-5-yl)-7-(3,6-diazabicyclo[3.2.1]octan-3-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 12-(4-chloro-2-methylindazol-5-yl)-7-(3,6-diazabicyclo[3.2.1]octan-3-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 162728639 |
| Molecular Formula | C22H21ClN8 |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 12-(4-chloro-2-methylindazol-5-yl)-7-(3,6-diazabicyclo[3.2.1]octan-3-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cn1cc2c(Cl)c(-c3c[nH]c4nc(N5CC6CNC(C6)C5)n5ccnc5c34)ccc2n1 |
| InChI | InChI=1S/C22H21ClN8/c1-29-11-16-17(28-29)3-2-14(19(16)23)15-8-26-20-18(15)21-24-4-5-31(21)22(27-20)30-9-12-6-13(10-30)25-7-12/h2-5,8,11-13,25-26H,6-7,9-10H2,1H3 |
| InChIKey | DMATVRSBJRLDRT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |