C22H24ClN7O — CID 166973980
3-chloro-N-methyl-4-[7-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-12-yl]pyridin-2-amine (PubChem CID 166973980) has the molecular formula C22H24ClN7O and a molecular weight of 437.94 g/mol. Its IUPAC name is 3-chloro-N-methyl-4-[7-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-12-yl]pyridin-2-amine.
| Compound Name | 3-chloro-N-methyl-4-[7-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-12-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 166973980 |
| Molecular Formula | C22H24ClN7O |
| Molecular Weight | 437.94 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-chloro-N-methyl-4-[7-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-12-yl]pyridin-2-amine |
| SMILES | CNc1nccc(-c2c[nH]c3nc(N4CCC5(CCOC5)CC4)n4ccnc4c23)c1Cl |
| InChI | InChI=1S/C22H24ClN7O/c1-24-19-17(23)14(2-6-25-19)15-12-27-18-16(15)20-26-7-10-30(20)21(28-18)29-8-3-22(4-9-29)5-11-31-13-22/h2,6-7,10,12,27H,3-5,8-9,11,13H2,1H3,(H,24,25) |
| InChIKey | OSRFPZVQLHBTIQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |