C12H22F3NO — CID 162730744
(4S)-1-methyl-2-propan-2-yl-4-(4,4,4-trifluorobutoxy)pyrrolidine (PubChem CID 162730744) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is (4S)-1-methyl-2-propan-2-yl-4-(4,4,4-trifluorobutoxy)pyrrolidine.
| Compound Name | (4S)-1-methyl-2-propan-2-yl-4-(4,4,4-trifluorobutoxy)pyrrolidine |
|---|---|
| PubChem CID | 162730744 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (4S)-1-methyl-2-propan-2-yl-4-(4,4,4-trifluorobutoxy)pyrrolidine |
| SMILES | CC(C)C1C[C@H](OCCCC(F)(F)F)CN1C |
| InChI | InChI=1S/C12H22F3NO/c1-9(2)11-7-10(8-16(11)3)17-6-4-5-12(13,14)15/h9-11H,4-8H2,1-3H3/t10-,11?/m0/s1 |
| InChIKey | KJSSHAVSLWKHCG-VUWPPUDQSA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|