C10H16FN — CID 162730748
1-fluoro-8-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 162730748) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is 1-fluoro-8-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 1-fluoro-8-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 162730748 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 1-fluoro-8-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=CCC12CCCN1CCC2F |
| InChI | InChI=1S/C10H16FN/c1-2-5-10-6-3-7-12(10)8-4-9(10)11/h2,9H,1,3-8H2 |
| InChIKey | FVGZJUIWTUOKJN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|