C9H14FN — CID 164922807
8-ethenyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 164922807) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 8-ethenyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-ethenyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 164922807 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 8-ethenyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=CC12CCCN1CC(F)C2 |
| InChI | InChI=1S/C9H14FN/c1-2-9-4-3-5-11(9)7-8(10)6-9/h2,8H,1,3-7H2 |
| InChIKey | GQWZJCYEOZPKPG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|