C13H21FO — CID 162730768
[(1S,4R)-1-butyl-4-ethenyl-4-fluoro-2-methylidenecyclopentyl]methanol (PubChem CID 162730768) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is [(1S,4R)-1-butyl-4-ethenyl-4-fluoro-2-methylidenecyclopentyl]methanol.
| Compound Name | [(1S,4R)-1-butyl-4-ethenyl-4-fluoro-2-methylidenecyclopentyl]methanol |
|---|---|
| PubChem CID | 162730768 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | [(1S,4R)-1-butyl-4-ethenyl-4-fluoro-2-methylidenecyclopentyl]methanol |
| SMILES | C=C[C@@]1(F)CC(=C)[C@](CO)(CCCC)C1 |
| InChI | InChI=1S/C13H21FO/c1-4-6-7-12(10-15)9-13(14,5-2)8-11(12)3/h5,15H,2-4,6-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | RCGQBKPVQBJVBI-CHWSQXEVSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|