C21H23N7O4S — CID 162733029
8-(methylamino)-N-[(3R)-1-methyl-2-(oxomethylidene)pyrrolidin-3-yl]-6-(2-methylsulfonylanilino)imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 162733029) has the molecular formula C21H23N7O4S and a molecular weight of 469.53 g/mol. Its IUPAC name is 8-(methylamino)-N-[(3R)-1-methyl-2-(oxomethylidene)pyrrolidin-3-yl]-6-(2-methylsulfonylanilino)imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 8-(methylamino)-N-[(3R)-1-methyl-2-(oxomethylidene)pyrrolidin-3-yl]-6-(2-methylsulfonylanilino)imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 162733029 |
| Molecular Formula | C21H23N7O4S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 8-(methylamino)-N-[(3R)-1-methyl-2-(oxomethylidene)pyrrolidin-3-yl]-6-(2-methylsulfonylanilino)imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CNc1cc(Nc2ccccc2S(C)(=O)=O)nn2c(C(=O)N[C@@H]3CCN(C)C3=C=O)cnc12 |
| InChI | InChI=1S/C21H23N7O4S/c1-22-15-10-19(24-14-6-4-5-7-18(14)33(3,31)32)26-28-16(11-23-20(15)28)21(30)25-13-8-9-27(2)17(13)12-29/h4-7,10-11,13,22H,8-9H2,1-3H3,(H,24,26)(H,25,30)/t13-/m1/s1 |
| InChIKey | NAZLYIWZKGCURM-CYBMUJFWSA-N |
| XLogP | 1.07 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|