C14H20N6O — CID 162764665
N-cyclopentyl-6,8-bis(methylamino)imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 162764665) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is N-cyclopentyl-6,8-bis(methylamino)imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | N-cyclopentyl-6,8-bis(methylamino)imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 162764665 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-cyclopentyl-6,8-bis(methylamino)imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CNc1cc(NC)c2ncc(C(=O)NC3CCCC3)n2n1 |
| InChI | InChI=1S/C14H20N6O/c1-15-10-7-12(16-2)19-20-11(8-17-13(10)20)14(21)18-9-5-3-4-6-9/h7-9,15H,3-6H2,1-2H3,(H,16,19)(H,18,21) |
| InChIKey | ZTVFRVSIWPQYPW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|