C21H25N7O — CID 59624903
6-(cyclohexylamino)-8-(cyclopropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624903) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 6-(cyclohexylamino)-8-(cyclopropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-(cyclohexylamino)-8-(cyclopropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624903 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 6-(cyclohexylamino)-8-(cyclopropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cnc2c(NC3CC3)cc(NC3CCCCC3)nn12 |
| InChI | InChI=1S/C21H25N7O/c29-21(26-16-8-10-22-11-9-16)18-13-23-20-17(24-15-6-7-15)12-19(27-28(18)20)25-14-4-2-1-3-5-14/h8-15,24H,1-7H2,(H,25,27)(H,22,26,29) |
| InChIKey | MMABOAIRJLLSAG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|