C26H30N8O — CID 143846794
6-(cyclohexylamino)-8-[4-(dimethylamino)anilino]-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 143846794) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 6-(cyclohexylamino)-8-[4-(dimethylamino)anilino]-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-(cyclohexylamino)-8-[4-(dimethylamino)anilino]-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 143846794 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 6-(cyclohexylamino)-8-[4-(dimethylamino)anilino]-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CN(C)c1ccc(Nc2cc(NC3CCCCC3)nn3c(C(=O)Nc4ccncc4)cnc23)cc1 |
| InChI | InChI=1S/C26H30N8O/c1-33(2)21-10-8-19(9-11-21)29-22-16-24(30-18-6-4-3-5-7-18)32-34-23(17-28-25(22)34)26(35)31-20-12-14-27-15-13-20/h8-18,29H,3-7H2,1-2H3,(H,30,32)(H,27,31,35) |
| InChIKey | ITOHSWJMNCWQGW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|