C21H21N7O — CID 143846758
6-amino-8-anilino-N-[4-(dimethylamino)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 143846758) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 6-amino-8-anilino-N-[4-(dimethylamino)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-amino-8-anilino-N-[4-(dimethylamino)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 143846758 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 6-amino-8-anilino-N-[4-(dimethylamino)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cnc3c(Nc4ccccc4)cc(N)nn23)cc1 |
| InChI | InChI=1S/C21H21N7O/c1-27(2)16-10-8-15(9-11-16)25-21(29)18-13-23-20-17(12-19(22)26-28(18)20)24-14-6-4-3-5-7-14/h3-13,24H,1-2H3,(H2,22,26)(H,25,29) |
| InChIKey | QMYSDRCSZSGVLX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|