C19H17N7O — CID 143846848
6-amino-8-(benzylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 143846848) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 6-amino-8-(benzylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-amino-8-(benzylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 143846848 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 6-amino-8-(benzylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | Nc1cc(NCc2ccccc2)c2ncc(C(=O)Nc3ccncc3)n2n1 |
| InChI | InChI=1S/C19H17N7O/c20-17-10-15(22-11-13-4-2-1-3-5-13)18-23-12-16(26(18)25-17)19(27)24-14-6-8-21-9-7-14/h1-10,12,22H,11H2,(H2,20,25)(H,21,24,27) |
| InChIKey | QEGAWMJYUXSQST-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|