C21H28N8O2 — CID 59624815
6-[(4-aminocyclohexyl)amino]-8-(3-hydroxypropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624815) has the molecular formula C21H28N8O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 6-[(4-aminocyclohexyl)amino]-8-(3-hydroxypropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[(4-aminocyclohexyl)amino]-8-(3-hydroxypropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624815 |
| Molecular Formula | C21H28N8O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 6-[(4-aminocyclohexyl)amino]-8-(3-hydroxypropylamino)-N-pyridin-4-ylimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | NC1CCC(Nc2cc(NCCCO)c3ncc(C(=O)Nc4ccncc4)n3n2)CC1 |
| InChI | InChI=1S/C21H28N8O2/c22-14-2-4-15(5-3-14)26-19-12-17(24-8-1-11-30)20-25-13-18(29(20)28-19)21(31)27-16-6-9-23-10-7-16/h6-7,9-10,12-15,24,30H,1-5,8,11,22H2,(H,26,28)(H,23,27,31) |
| InChIKey | JXLLUMUGNYAIIC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|