C25H26FN7O — CID 59624739
6-[(4-aminocyclohexyl)amino]-8-anilino-N-(4-fluorophenyl)imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624739) has the molecular formula C25H26FN7O and a molecular weight of 459.53 g/mol. Its IUPAC name is 6-[(4-aminocyclohexyl)amino]-8-anilino-N-(4-fluorophenyl)imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[(4-aminocyclohexyl)amino]-8-anilino-N-(4-fluorophenyl)imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624739 |
| Molecular Formula | C25H26FN7O |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 6-[(4-aminocyclohexyl)amino]-8-anilino-N-(4-fluorophenyl)imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | NC1CCC(Nc2cc(Nc3ccccc3)c3ncc(C(=O)Nc4ccc(F)cc4)n3n2)CC1 |
| InChI | InChI=1S/C25H26FN7O/c26-16-6-10-20(11-7-16)31-25(34)22-15-28-24-21(29-18-4-2-1-3-5-18)14-23(32-33(22)24)30-19-12-8-17(27)9-13-19/h1-7,10-11,14-15,17,19,29H,8-9,12-13,27H2,(H,30,32)(H,31,34) |
| InChIKey | VOIOHCILZVIVMJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|