About 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate
1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate (PubChem CID 162734092) has the molecular formula C19H32O6
and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate |
| PubChem CID | 162734092 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate |
| SMILES | CCCCCC[C@@H](C)OC(=O)/C=C/C(=O)OCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32O6/c1-6-7-8-9-10-15(2)24-17(21)12-11-16(20)23-14-13-18(22)25-19(3,4)5/h11-12,15H,6-10,13-14H2,1-5H3/b12-11+/t15-/m1/s1 |
| InChIKey | WINXBURAVRFWPE-AYJWMTRPSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate?
The IUPAC name of 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate (CID 162734092) is 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate.
What is the SMILES notation for 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate?
The canonical SMILES for 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate is CCCCCC[C@@H](C)OC(=O)/C=C/C(=O)OCCC(=O)OC(C)(C)C.
What is the InChIKey of 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate?
The InChIKey is WINXBURAVRFWPE-AYJWMTRPSA-N. The full InChI is InChI=1S/C19H32O6/c1-6-7-8-9-10-15(2)24-17(21)12-11-16(20)23-14-13-18(22)25-19(3,4)5/h11-12,15H,6-10,13-14H2,1-5H3/b12-11+/t15-/m1/s1.
What are the key properties of 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate?
1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate has a molecular weight of 356.46 g/mol, XLogP of 3.72, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 4-O-[(2R)-octan-2-yl] (E)-but-2-enedioate is sourced from PubChem (CID 162734092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).