About sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride
sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride (PubChem CID 174987256) has the molecular formula C20H37NaO4
and a molecular weight of 364.50 g/mol. Its IUPAC name is sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride.
Molecular Properties
| Compound Name | sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride |
| PubChem CID | 174987256 |
| Molecular Formula | C20H37NaO4 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride |
| SMILES | CCCCCCC(C)OC(=O)/C=C\C(=O)OC(C)CCCCCC.[H-].[Na+] |
| InChI | InChI=1S/C20H36O4.Na.H/c1-5-7-9-11-13-17(3)23-19(21)15-16-20(22)24-18(4)14-12-10-8-6-2;;/h15-18H,5-14H2,1-4H3;;/q;+1;-1/b16-15-;; |
| InChIKey | PJIFZWWNGJEPLJ-NDXGFPCWSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride?
The IUPAC name of sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride (CID 174987256) is sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride.
What is the SMILES notation for sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride?
The canonical SMILES for sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride is CCCCCCC(C)OC(=O)/C=C\C(=O)OC(C)CCCCCC.[H-].[Na+].
What is the InChIKey of sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride?
The InChIKey is PJIFZWWNGJEPLJ-NDXGFPCWSA-N. The full InChI is InChI=1S/C20H36O4.Na.H/c1-5-7-9-11-13-17(3)23-19(21)15-16-20(22)24-18(4)14-12-10-8-6-2;;/h15-18H,5-14H2,1-4H3;;/q;+1;-1/b16-15-;;.
What are the key properties of sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride?
sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride has a molecular weight of 364.50 g/mol, XLogP of 2.46, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dioctan-2-yl (Z)-but-2-enedioate;hydride is sourced from PubChem (CID 174987256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).