About octan-2-yl 3-cyanoprop-2-enoate
octan-2-yl 3-cyanoprop-2-enoate (PubChem CID 53417148) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is octan-2-yl 3-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | octan-2-yl 3-cyanoprop-2-enoate |
| PubChem CID | 53417148 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | octan-2-yl 3-cyanoprop-2-enoate |
| SMILES | CCCCCCC(C)OC(=O)C=CC#N |
| InChI | InChI=1S/C12H19NO2/c1-3-4-5-6-8-11(2)15-12(14)9-7-10-13/h7,9,11H,3-6,8H2,1-2H3 |
| InChIKey | JPJBLJYIWFFPCG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 3-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 3-cyanoprop-2-enoate?
The IUPAC name of octan-2-yl 3-cyanoprop-2-enoate (CID 53417148) is octan-2-yl 3-cyanoprop-2-enoate.
What is the SMILES notation for octan-2-yl 3-cyanoprop-2-enoate?
The canonical SMILES for octan-2-yl 3-cyanoprop-2-enoate is CCCCCCC(C)OC(=O)C=CC#N.
What is the InChIKey of octan-2-yl 3-cyanoprop-2-enoate?
The InChIKey is JPJBLJYIWFFPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-3-4-5-6-8-11(2)15-12(14)9-7-10-13/h7,9,11H,3-6,8H2,1-2H3.
What are the key properties of octan-2-yl 3-cyanoprop-2-enoate?
octan-2-yl 3-cyanoprop-2-enoate has a molecular weight of 209.29 g/mol, XLogP of 2.97, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 3-cyanoprop-2-enoate is sourced from PubChem (CID 53417148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).