C24H37FN2O3 — CID 162735021
ethane;methyl 3-amino-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 162735021) has the molecular formula C24H37FN2O3 and a molecular weight of 420.57 g/mol. Its IUPAC name is ethane;methyl 3-amino-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | ethane;methyl 3-amino-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 162735021 |
| Molecular Formula | C24H37FN2O3 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | ethane;methyl 3-amino-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CC.COC(=O)N1C(COC2CCC(c3cccc(F)c3)CC2)C(N)C2CCCC21 |
| InChI | InChI=1S/C22H31FN2O3.C2H6/c1-27-22(26)25-19-7-3-6-18(19)21(24)20(25)13-28-17-10-8-14(9-11-17)15-4-2-5-16(23)12-15;1-2/h2,4-5,12,14,17-21H,3,6-11,13,24H2,1H3;1-2H3 |
| InChIKey | AYYNNYLLUUSRIS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |