C23H34FN3O5S — CID 163757868
methyl (2R,3S,3aS,6aR)-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(methylsulfamoylamino)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 163757868) has the molecular formula C23H34FN3O5S and a molecular weight of 483.61 g/mol. Its IUPAC name is methyl (2R,3S,3aS,6aR)-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(methylsulfamoylamino)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | methyl (2R,3S,3aS,6aR)-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(methylsulfamoylamino)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 163757868 |
| Molecular Formula | C23H34FN3O5S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | methyl (2R,3S,3aS,6aR)-2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(methylsulfamoylamino)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CNS(=O)(=O)N[C@H]1[C@H]2CCC[C@H]2N(C(=O)OC)[C@H]1COC1CCC(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H34FN3O5S/c1-25-33(29,30)26-22-19-7-4-8-20(19)27(23(28)31-2)21(22)14-32-18-11-9-15(10-12-18)16-5-3-6-17(24)13-16/h3,5-6,13,15,18-22,25-26H,4,7-12,14H2,1-2H3/t15?,18?,19-,20+,21-,22-/m0/s1 |
| InChIKey | LVQMVVZYTLUFHP-CPDKOKCRSA-N |
| XLogP | 2.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |