C23H36N2O5S — CID 170111161
N-[(2R,3S,3aS,6aR)-1-[hydroxy(methoxy)methyl]-2-[(4-phenylcyclohexyl)oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]methanesulfonamide (PubChem CID 170111161) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[(2R,3S,3aS,6aR)-1-[hydroxy(methoxy)methyl]-2-[(4-phenylcyclohexyl)oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]methanesulfonamide.
| Compound Name | N-[(2R,3S,3aS,6aR)-1-[hydroxy(methoxy)methyl]-2-[(4-phenylcyclohexyl)oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170111161 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[(2R,3S,3aS,6aR)-1-[hydroxy(methoxy)methyl]-2-[(4-phenylcyclohexyl)oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]methanesulfonamide |
| SMILES | COC(O)N1[C@@H]2CCC[C@@H]2[C@H](NS(C)(=O)=O)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H36N2O5S/c1-29-23(26)25-20-10-6-9-19(20)22(24-31(2,27)28)21(25)15-30-18-13-11-17(12-14-18)16-7-4-3-5-8-16/h3-5,7-8,17-24,26H,6,9-15H2,1-2H3/t17?,18?,19-,20+,21-,22-,23?/m0/s1 |
| InChIKey | MMLAWGKPOPZKQT-URHMAQKDSA-N |
| XLogP | 2.42 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|