C18H17ClN2O2S — CID 162736463
6-chloro-1-cyclopropyl-4-methyl-2-(4-methylsulfonylphenyl)pyrrolo[3,2-c]pyridine (PubChem CID 162736463) has the molecular formula C18H17ClN2O2S and a molecular weight of 360.87 g/mol. Its IUPAC name is 6-chloro-1-cyclopropyl-4-methyl-2-(4-methylsulfonylphenyl)pyrrolo[3,2-c]pyridine.
| Compound Name | 6-chloro-1-cyclopropyl-4-methyl-2-(4-methylsulfonylphenyl)pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 162736463 |
| Molecular Formula | C18H17ClN2O2S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 6-chloro-1-cyclopropyl-4-methyl-2-(4-methylsulfonylphenyl)pyrrolo[3,2-c]pyridine |
| SMILES | Cc1nc(Cl)cc2c1cc(-c1ccc(S(C)(=O)=O)cc1)n2C1CC1 |
| InChI | InChI=1S/C18H17ClN2O2S/c1-11-15-9-16(12-3-7-14(8-4-12)24(2,22)23)21(13-5-6-13)17(15)10-18(19)20-11/h3-4,7-10,13H,5-6H2,1-2H3 |
| InChIKey | RCVWZVBWWVANHZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|