C10H14FN3O — CID 162736705
2-[1-(2-fluoroprop-2-enoyl)-4-methylpiperazin-2-yl]acetonitrile (PubChem CID 162736705) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-[1-(2-fluoroprop-2-enoyl)-4-methylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[1-(2-fluoroprop-2-enoyl)-4-methylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 162736705 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-[1-(2-fluoroprop-2-enoyl)-4-methylpiperazin-2-yl]acetonitrile |
| SMILES | C=C(F)C(=O)N1CCN(C)CC1CC#N |
| InChI | InChI=1S/C10H14FN3O/c1-8(11)10(15)14-6-5-13(2)7-9(14)3-4-12/h9H,1,3,5-7H2,2H3 |
| InChIKey | UIURRFAHNCLQKU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|