C14H21ClNO4P — CID 162738984
[3-[(4-chlorophenyl)carbamoyl]-5-methylhexyl]phosphonic acid (PubChem CID 162738984) has the molecular formula C14H21ClNO4P and a molecular weight of 333.75 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)carbamoyl]-5-methylhexyl]phosphonic acid.
| Compound Name | [3-[(4-chlorophenyl)carbamoyl]-5-methylhexyl]phosphonic acid |
|---|---|
| PubChem CID | 162738984 |
| Molecular Formula | C14H21ClNO4P |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [3-[(4-chlorophenyl)carbamoyl]-5-methylhexyl]phosphonic acid |
| SMILES | CC(C)CC(CCP(=O)(O)O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClNO4P/c1-10(2)9-11(7-8-21(18,19)20)14(17)16-13-5-3-12(15)4-6-13/h3-6,10-11H,7-9H2,1-2H3,(H,16,17)(H2,18,19,20) |
| InChIKey | GZTVQNFVFXWYNZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|