About 2-ethoxyquinazolin-6-ol
2-ethoxyquinazolin-6-ol (PubChem CID 162739873) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-ethoxyquinazolin-6-ol.
Molecular Properties
| Compound Name | 2-ethoxyquinazolin-6-ol |
| PubChem CID | 162739873 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-ethoxyquinazolin-6-ol |
| SMILES | CCOc1ncc2cc(O)ccc2n1 |
| InChI | InChI=1S/C10H10N2O2/c1-2-14-10-11-6-7-5-8(13)3-4-9(7)12-10/h3-6,13H,2H2,1H3 |
| InChIKey | WFARAICEHGMHME-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxyquinazolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyquinazolin-6-ol?
The IUPAC name of 2-ethoxyquinazolin-6-ol (CID 162739873) is 2-ethoxyquinazolin-6-ol.
What is the SMILES notation for 2-ethoxyquinazolin-6-ol?
The canonical SMILES for 2-ethoxyquinazolin-6-ol is CCOc1ncc2cc(O)ccc2n1.
What is the InChIKey of 2-ethoxyquinazolin-6-ol?
The InChIKey is WFARAICEHGMHME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-2-14-10-11-6-7-5-8(13)3-4-9(7)12-10/h3-6,13H,2H2,1H3.
What are the key properties of 2-ethoxyquinazolin-6-ol?
2-ethoxyquinazolin-6-ol has a molecular weight of 190.20 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyquinazolin-6-ol is sourced from PubChem (CID 162739873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).