C30H30IN5O5S — CID 162740397
4-[3-iodo-10-methyl-4-[4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-11-oxo-5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-yl]benzoic acid (PubChem CID 162740397) has the molecular formula C30H30IN5O5S and a molecular weight of 699.57 g/mol. Its IUPAC name is 4-[3-iodo-10-methyl-4-[4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-11-oxo-5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-yl]benzoic acid.
| Compound Name | 4-[3-iodo-10-methyl-4-[4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-11-oxo-5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-yl]benzoic acid |
|---|---|
| PubChem CID | 162740397 |
| Molecular Formula | C30H30IN5O5S |
| Molecular Weight | 699.57 g/mol |
| Exact Mass | 699.10 |
| IUPAC Name | 4-[3-iodo-10-methyl-4-[4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-11-oxo-5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-yl]benzoic acid |
| SMILES | CN1C(=O)N(c2ccc(C(=O)O)cc2)Cc2c1cnc1[nH]c(-c3ccc(CN4CCC(S(C)(=O)=O)CC4)cc3)c(I)c21 |
| InChI | InChI=1S/C30H30IN5O5S/c1-34-24-15-32-28-25(23(24)17-36(30(34)39)21-9-7-20(8-10-21)29(37)38)26(31)27(33-28)19-5-3-18(4-6-19)16-35-13-11-22(12-14-35)42(2,40)41/h3-10,15,22H,11-14,16-17H2,1-2H3,(H,32,33)(H,37,38) |
| InChIKey | OWPAPENDTNBNTH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|