C33H36N4O3S — CID 167175390
10-methyl-4-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-3-phenylspiro[5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-12,4'-oxane]-11-one (PubChem CID 167175390) has the molecular formula C33H36N4O3S and a molecular weight of 568.74 g/mol. Its IUPAC name is 10-methyl-4-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-3-phenylspiro[5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-12,4'-oxane]-11-one.
| Compound Name | 10-methyl-4-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-3-phenylspiro[5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-12,4'-oxane]-11-one |
|---|---|
| PubChem CID | 167175390 |
| Molecular Formula | C33H36N4O3S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 10-methyl-4-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-3-phenylspiro[5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-12,4'-oxane]-11-one |
| SMILES | CN1C(=O)C2(CCOCC2)c2c1cnc1[nH]c(-c3ccc(CN4CCC(S(C)=O)CC4)cc3)c(-c3ccccc3)c21 |
| InChI | InChI=1S/C33H36N4O3S/c1-36-26-20-34-31-28(29(26)33(32(36)38)14-18-40-19-15-33)27(23-6-4-3-5-7-23)30(35-31)24-10-8-22(9-11-24)21-37-16-12-25(13-17-37)41(2)39/h3-11,20,25H,12-19,21H2,1-2H3,(H,34,35) |
| InChIKey | FBXSSEWGQXJDQQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |