C28H29N5O2S — CID 162432529
5-methyl-11-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-12-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 162432529) has the molecular formula C28H29N5O2S and a molecular weight of 499.64 g/mol. Its IUPAC name is 5-methyl-11-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-12-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 5-methyl-11-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-12-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 162432529 |
| Molecular Formula | C28H29N5O2S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 5-methyl-11-[4-[(4-methylsulfinylpiperidin-1-yl)methyl]phenyl]-12-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | Cn1c(=O)[nH]c2c3c(-c4ccccc4)c(-c4ccc(CN5CCC(S(C)=O)CC5)cc4)[nH]c3ncc21 |
| InChI | InChI=1S/C28H29N5O2S/c1-32-22-16-29-27-24(26(22)31-28(32)34)23(19-6-4-3-5-7-19)25(30-27)20-10-8-18(9-11-20)17-33-14-12-21(13-15-33)36(2)35/h3-11,16,21H,12-15,17H2,1-2H3,(H,29,30)(H,31,34) |
| InChIKey | KIFDQNVEONCPKF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |