About ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one
ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one (PubChem CID 162740825) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one |
| PubChem CID | 162740825 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one |
| SMILES | C=C.C=C(/C=C\C)CN1CCOC(C(=O)C(=C)OCC)C1 |
| InChI | InChI=1S/C15H23NO3.C2H4/c1-5-7-12(3)10-16-8-9-19-14(11-16)15(17)13(4)18-6-2;1-2/h5,7,14H,3-4,6,8-11H2,1-2H3;1-2H2/b7-5-; |
| InChIKey | NDZXBURPEQZWTK-YJOCEBFMSA-N |
| XLogP | 2.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one?
The IUPAC name of ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one (CID 162740825) is ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one.
What is the SMILES notation for ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one?
The canonical SMILES for ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one is C=C.C=C(/C=C\C)CN1CCOC(C(=O)C(=C)OCC)C1.
What is the InChIKey of ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one?
The InChIKey is NDZXBURPEQZWTK-YJOCEBFMSA-N. The full InChI is InChI=1S/C15H23NO3.C2H4/c1-5-7-12(3)10-16-8-9-19-14(11-16)15(17)13(4)18-6-2;1-2/h5,7,14H,3-4,6,8-11H2,1-2H3;1-2H2/b7-5-;.
What are the key properties of ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one?
ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one has a molecular weight of 293.41 g/mol, XLogP of 2.74, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-ethoxy-1-[4-[(Z)-2-methylidenepent-3-enyl]morpholin-2-yl]prop-2-en-1-one is sourced from PubChem (CID 162740825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).