C15H22FNO2 — CID 143482919
1-[4-[(3Z)-7-fluoro-2-methylideneocta-3,7-dienyl]morpholin-2-yl]ethanone (PubChem CID 143482919) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 1-[4-[(3Z)-7-fluoro-2-methylideneocta-3,7-dienyl]morpholin-2-yl]ethanone.
| Compound Name | 1-[4-[(3Z)-7-fluoro-2-methylideneocta-3,7-dienyl]morpholin-2-yl]ethanone |
|---|---|
| PubChem CID | 143482919 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-[4-[(3Z)-7-fluoro-2-methylideneocta-3,7-dienyl]morpholin-2-yl]ethanone |
| SMILES | C=C(F)CC/C=C\C(=C)CN1CCOC(C(C)=O)C1 |
| InChI | InChI=1S/C15H22FNO2/c1-12(6-4-5-7-13(2)16)10-17-8-9-19-15(11-17)14(3)18/h4,6,15H,1-2,5,7-11H2,3H3/b6-4- |
| InChIKey | KDBMDOKWMBERRF-XQRVVYSFSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|