C22H13BrCl2FN3O3 — CID 162741632
(3-amino-2-fluoro-6-methoxyphenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 162741632) has the molecular formula C22H13BrCl2FN3O3 and a molecular weight of 537.17 g/mol. Its IUPAC name is (3-amino-2-fluoro-6-methoxyphenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2-fluoro-6-methoxyphenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 162741632 |
| Molecular Formula | C22H13BrCl2FN3O3 |
| Molecular Weight | 537.17 g/mol |
| Exact Mass | 534.95 |
| IUPAC Name | (3-amino-2-fluoro-6-methoxyphenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | COc1ccc(N)c(F)c1C(=O)c1cn(C(=O)c2c(Cl)cccc2Cl)c2ncc(Br)cc12 |
| InChI | InChI=1S/C22H13BrCl2FN3O3/c1-32-16-6-5-15(27)19(26)18(16)20(30)12-9-29(21-11(12)7-10(23)8-28-21)22(31)17-13(24)3-2-4-14(17)25/h2-9H,27H2,1H3 |
| InChIKey | WKCGQQOAVAPBQK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.17 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|