C28H16Cl3F2N3O2 — CID 154022268
2-(3-amino-2,6-difluorophenyl)-1-[5-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone (PubChem CID 154022268) has the molecular formula C28H16Cl3F2N3O2 and a molecular weight of 570.81 g/mol. Its IUPAC name is 2-(3-amino-2,6-difluorophenyl)-1-[5-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone.
| Compound Name | 2-(3-amino-2,6-difluorophenyl)-1-[5-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 154022268 |
| Molecular Formula | C28H16Cl3F2N3O2 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 2-(3-amino-2,6-difluorophenyl)-1-[5-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone |
| SMILES | Nc1ccc(F)c(CC(=O)c2cn(C(=O)c3c(Cl)cccc3Cl)c3ncc(-c4ccc(Cl)cc4)cc23)c1F |
| InChI | InChI=1S/C28H16Cl3F2N3O2/c29-16-6-4-14(5-7-16)15-10-17-19(24(37)11-18-22(32)8-9-23(34)26(18)33)13-36(27(17)35-12-15)28(38)25-20(30)2-1-3-21(25)31/h1-10,12-13H,11,34H2 |
| InChIKey | LRTPCAYIYDWPFJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|