C21H12BrCl2N3O2 — CID 146302448
(3-aminophenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 146302448) has the molecular formula C21H12BrCl2N3O2 and a molecular weight of 489.16 g/mol. Its IUPAC name is (3-aminophenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-aminophenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 146302448 |
| Molecular Formula | C21H12BrCl2N3O2 |
| Molecular Weight | 489.16 g/mol |
| Exact Mass | 486.95 |
| IUPAC Name | (3-aminophenyl)-[5-bromo-1-(2,6-dichlorobenzoyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | Nc1cccc(C(=O)c2cn(C(=O)c3c(Cl)cccc3Cl)c3ncc(Br)cc23)c1 |
| InChI | InChI=1S/C21H12BrCl2N3O2/c22-12-8-14-15(19(28)11-3-1-4-13(25)7-11)10-27(20(14)26-9-12)21(29)18-16(23)5-2-6-17(18)24/h1-10H,25H2 |
| InChIKey | HMKMLOIOQLSOFT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.16 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|