C15H30N3+ — CID 162741740
2,3a,6a-trimethyl-5-(piperidin-1-ium-4-ylmethyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole (PubChem CID 162741740) has the molecular formula C15H30N3+ and a molecular weight of 252.43 g/mol. Its IUPAC name is 2,3a,6a-trimethyl-5-(piperidin-1-ium-4-ylmethyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2,3a,6a-trimethyl-5-(piperidin-1-ium-4-ylmethyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 162741740 |
| Molecular Formula | C15H30N3+ |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.24 |
| IUPAC Name | 2,3a,6a-trimethyl-5-(piperidin-1-ium-4-ylmethyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1CC2(C)CN(CC3CC[NH2+]CC3)CC2(C)C1 |
| InChI | InChI=1S/C15H29N3/c1-14-9-17(3)10-15(14,2)12-18(11-14)8-13-4-6-16-7-5-13/h13,16H,4-12H2,1-3H3/p+1 |
| InChIKey | JYXBDJSMGGSACY-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 23.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |