C12H20N2O2 — CID 162743562
methyl (2R)-1-[(E)-1-ethyliminobut-2-en-2-yl]pyrrolidine-2-carboxylate (PubChem CID 162743562) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (2R)-1-[(E)-1-ethyliminobut-2-en-2-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[(E)-1-ethyliminobut-2-en-2-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 162743562 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | methyl (2R)-1-[(E)-1-ethyliminobut-2-en-2-yl]pyrrolidine-2-carboxylate |
| SMILES | C/C=C(\C=N\CC)N1CCC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H20N2O2/c1-4-10(9-13-5-2)14-8-6-7-11(14)12(15)16-3/h4,9,11H,5-8H2,1-3H3/b10-4+,13-9+/t11-/m1/s1 |
| InChIKey | ICBTVIHVYJRTIO-ISSVFBGCSA-N |
| XLogP | 1.62 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|