C32H35FN6O2S — CID 162743746
N-[4-[(2R)-1-[4-[(1-acetylpiperidin-4-yl)methyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide (PubChem CID 162743746) has the molecular formula C32H35FN6O2S and a molecular weight of 586.74 g/mol. Its IUPAC name is N-[4-[(2R)-1-[4-[(1-acetylpiperidin-4-yl)methyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide.
| Compound Name | N-[4-[(2R)-1-[4-[(1-acetylpiperidin-4-yl)methyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743746 |
| Molecular Formula | C32H35FN6O2S |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | N-[4-[(2R)-1-[4-[(1-acetylpiperidin-4-yl)methyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide |
| SMILES | CC(=O)N1CCC(Cc2ccc(N3CCC[C@@H]3c3csc(NC(=O)c4cccn4Cc4ccnc(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C32H35FN6O2S/c1-22(40)37-16-11-24(12-17-37)18-23-6-8-26(9-7-23)39-15-3-4-28(39)27-21-42-32(35-27)36-31(41)29-5-2-14-38(29)20-25-10-13-34-30(33)19-25/h2,5-10,13-14,19,21,24,28H,3-4,11-12,15-18,20H2,1H3,(H,35,36,41)/t28-/m1/s1 |
| InChIKey | GVFZNEOHHMCDHJ-MUUNZHRXSA-N |
| XLogP | 5.92 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|