C25H25N5OS — CID 162743950
N-[4-[(2R)-1-(4-methylphenyl)pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide (PubChem CID 162743950) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is N-[4-[(2R)-1-(4-methylphenyl)pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | N-[4-[(2R)-1-(4-methylphenyl)pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743950 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[4-[(2R)-1-(4-methylphenyl)pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
| SMILES | Cc1ccc(N2CCC[C@@H]2c2csc(NC(=O)c3cccn3Cc3ccncc3)n2)cc1 |
| InChI | InChI=1S/C25H25N5OS/c1-18-6-8-20(9-7-18)30-15-3-4-22(30)21-17-32-25(27-21)28-24(31)23-5-2-14-29(23)16-19-10-12-26-13-11-19/h2,5-14,17,22H,3-4,15-16H2,1H3,(H,27,28,31)/t22-/m1/s1 |
| InChIKey | FQFGCCCPDZRFFU-JOCHJYFZSA-N |
| XLogP | 5.29 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|