C28H29N5O3S — CID 162743560
N-[4-[(2R)-1-[4-(oxolan-3-yloxy)phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide (PubChem CID 162743560) has the molecular formula C28H29N5O3S and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[4-[(2R)-1-[4-(oxolan-3-yloxy)phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | N-[4-[(2R)-1-[4-(oxolan-3-yloxy)phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743560 |
| Molecular Formula | C28H29N5O3S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | N-[4-[(2R)-1-[4-(oxolan-3-yloxy)phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1nc([C@H]2CCCN2c2ccc(OC3CCOC3)cc2)cs1)c1cccn1Cc1ccncc1 |
| InChI | InChI=1S/C28H29N5O3S/c34-27(26-4-1-14-32(26)17-20-9-12-29-13-10-20)31-28-30-24(19-37-28)25-3-2-15-33(25)21-5-7-22(8-6-21)36-23-11-16-35-18-23/h1,4-10,12-14,19,23,25H,2-3,11,15-18H2,(H,30,31,34)/t23?,25-/m1/s1 |
| InChIKey | BBWZPIIWIWUFSR-XSWBTSGESA-N |
| XLogP | 5.15 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|