C28H30FN7O4S2 — CID 169049120
1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-[4-[1-(methylsulfamoyl)azetidin-3-yl]oxyphenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide (PubChem CID 169049120) has the molecular formula C28H30FN7O4S2 and a molecular weight of 611.73 g/mol. Its IUPAC name is 1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-[4-[1-(methylsulfamoyl)azetidin-3-yl]oxyphenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide.
| Compound Name | 1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-[4-[1-(methylsulfamoyl)azetidin-3-yl]oxyphenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 169049120 |
| Molecular Formula | C28H30FN7O4S2 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | 1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-[4-[1-(methylsulfamoyl)azetidin-3-yl]oxyphenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)N1CC(Oc2ccc(N3CCC[C@@H]3c3csc(NC(=O)c4cccn4Cc4ccnc(F)c4)n3)cc2)C1 |
| InChI | InChI=1S/C28H30FN7O4S2/c1-30-42(38,39)35-16-22(17-35)40-21-8-6-20(7-9-21)36-13-3-4-24(36)23-18-41-28(32-23)33-27(37)25-5-2-12-34(25)15-19-10-11-31-26(29)14-19/h2,5-12,14,18,22,24,30H,3-4,13,15-17H2,1H3,(H,32,33,37)/t24-/m1/s1 |
| InChIKey | GNQSZNKBVPRLQM-XMMPIXPASA-N |
| XLogP | 3.65 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|